C14H15F2N5O2 — CID 174999541
[(1R)-1-[4-[4-amino-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl] carbamate (PubChem CID 174999541) has the molecular formula C14H15F2N5O2 and a molecular weight of 323.30 g/mol. Its IUPAC name is [(1R)-1-[4-[4-amino-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl] carbamate.
| Compound Name | [(1R)-1-[4-[4-amino-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl] carbamate |
|---|---|
| PubChem CID | 174999541 |
| Molecular Formula | C14H15F2N5O2 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [(1R)-1-[4-[4-amino-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl] carbamate |
| SMILES | C=CC[C@@H](OC(N)=O)c1cc(-c2c(N)cnn2C(F)F)ccn1 |
| InChI | InChI=1S/C14H15F2N5O2/c1-2-3-11(23-14(18)22)10-6-8(4-5-19-10)12-9(17)7-20-21(12)13(15)16/h2,4-7,11,13H,1,3,17H2,(H2,18,22)/t11-/m1/s1 |
| InChIKey | HESIMXQVBCTUTM-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|