About carbanide;chloropalladium(1+);tricyclopentylphosphane
carbanide;chloropalladium(1+);tricyclopentylphosphane (PubChem CID 175000126) has the molecular formula C16H30ClPPd
and a molecular weight of 395.26 g/mol. Its IUPAC name is carbanide;chloropalladium(1+);tricyclopentylphosphane.
Molecular Properties
| Compound Name | carbanide;chloropalladium(1+);tricyclopentylphosphane |
| PubChem CID | 175000126 |
| Molecular Formula | C16H30ClPPd |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | carbanide;chloropalladium(1+);tricyclopentylphosphane |
| SMILES | C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl[Pd+].[CH3-] |
| InChI | InChI=1S/C15H27P.CH3.ClH.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;;;/h13-15H,1-12H2;1H3;1H;/q;-1;;+2/p-1 |
| InChIKey | QLWDZUXIOGHLOD-UHFFFAOYSA-M |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chloropalladium(1+);tricyclopentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chloropalladium(1+);tricyclopentylphosphane?
The IUPAC name of carbanide;chloropalladium(1+);tricyclopentylphosphane (CID 175000126) is carbanide;chloropalladium(1+);tricyclopentylphosphane.
What is the SMILES notation for carbanide;chloropalladium(1+);tricyclopentylphosphane?
The canonical SMILES for carbanide;chloropalladium(1+);tricyclopentylphosphane is C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl[Pd+].[CH3-].
What is the InChIKey of carbanide;chloropalladium(1+);tricyclopentylphosphane?
The InChIKey is QLWDZUXIOGHLOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H27P.CH3.ClH.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;;;/h13-15H,1-12H2;1H3;1H;/q;-1;;+2/p-1.
What are the key properties of carbanide;chloropalladium(1+);tricyclopentylphosphane?
carbanide;chloropalladium(1+);tricyclopentylphosphane has a molecular weight of 395.26 g/mol, XLogP of 6.43, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chloropalladium(1+);tricyclopentylphosphane is sourced from PubChem (CID 175000126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).