C11H13N3O3 — CID 175000638
1,3-diazinane-2,4,6-trione;4-methylaniline (PubChem CID 175000638) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1,3-diazinane-2,4,6-trione;4-methylaniline.
| Compound Name | 1,3-diazinane-2,4,6-trione;4-methylaniline |
|---|---|
| PubChem CID | 175000638 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1,3-diazinane-2,4,6-trione;4-methylaniline |
| SMILES | Cc1ccc(N)cc1.O=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C7H9N.C4H4N2O3/c1-6-2-4-7(8)5-3-6;7-2-1-3(8)6-4(9)5-2/h2-5H,8H2,1H3;1H2,(H2,5,6,7,8,9) |
| InChIKey | DYEFGCFRBNURJX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|