About 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide
1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide (PubChem CID 175000829) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide |
| PubChem CID | 175000829 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC.O=C1CN=CN1 |
| InChI | InChI=1S/C6H11NO.C3H4N2O/c1-4-7-6(8)5(2)3;6-3-1-4-2-5-3/h2,4H2,1,3H3,(H,7,8);2H,1H2,(H,4,5,6) |
| InChIKey | CTDYJYAGOGAKCX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide?
The IUPAC name of 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide (CID 175000829) is 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide.
What is the SMILES notation for 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide?
The canonical SMILES for 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide is C=C(C)C(=O)NCC.O=C1CN=CN1.
What is the InChIKey of 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide?
The InChIKey is CTDYJYAGOGAKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C3H4N2O/c1-4-7-6(8)5(2)3;6-3-1-4-2-5-3/h2,4H2,1,3H3,(H,7,8);2H,1H2,(H,4,5,6).
What are the key properties of 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide?
1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide has a molecular weight of 197.24 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroimidazol-5-one;N-ethyl-2-methylprop-2-enamide is sourced from PubChem (CID 175000829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).