About 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride
4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride (PubChem CID 175000898) has the molecular formula C11H9Cl2F3N2S
and a molecular weight of 329.17 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride |
| PubChem CID | 175000898 |
| Molecular Formula | C11H9Cl2F3N2S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride |
| SMILES | CNc1sc(C(F)(F)F)nc1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C11H8ClF3N2S.ClH/c1-16-9-8(6-3-2-4-7(12)5-6)17-10(18-9)11(13,14)15;/h2-5,16H,1H3;1H |
| InChIKey | CMVMMBNKMGHQKD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride?
The IUPAC name of 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride (CID 175000898) is 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride.
What is the SMILES notation for 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride?
The canonical SMILES for 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride is CNc1sc(C(F)(F)F)nc1-c1cccc(Cl)c1.Cl.
What is the InChIKey of 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride?
The InChIKey is CMVMMBNKMGHQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF3N2S.ClH/c1-16-9-8(6-3-2-4-7(12)5-6)17-10(18-9)11(13,14)15;/h2-5,16H,1H3;1H.
What are the key properties of 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride?
4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride has a molecular weight of 329.17 g/mol, XLogP of 4.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-N-methyl-2-(trifluoromethyl)-1,3-thiazol-5-amine;hydrochloride is sourced from PubChem (CID 175000898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).