About pentane-1,1,2,3-tetrathiol
pentane-1,1,2,3-tetrathiol (PubChem CID 175001525) has the molecular formula C5H12S4
and a molecular weight of 200.42 g/mol. Its IUPAC name is pentane-1,1,2,3-tetrathiol.
Molecular Properties
| Compound Name | pentane-1,1,2,3-tetrathiol |
| PubChem CID | 175001525 |
| Molecular Formula | C5H12S4 |
| Molecular Weight | 200.42 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | pentane-1,1,2,3-tetrathiol |
| SMILES | CCC(S)C(S)C(S)S |
| InChI | InChI=1S/C5H12S4/c1-2-3(6)4(7)5(8)9/h3-9H,2H2,1H3 |
| InChIKey | MCMUAOILUJVTMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pentane-1,1,2,3-tetrathiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,1,2,3-tetrathiol?
The IUPAC name of pentane-1,1,2,3-tetrathiol (CID 175001525) is pentane-1,1,2,3-tetrathiol.
What is the SMILES notation for pentane-1,1,2,3-tetrathiol?
The canonical SMILES for pentane-1,1,2,3-tetrathiol is CCC(S)C(S)C(S)S.
What is the InChIKey of pentane-1,1,2,3-tetrathiol?
The InChIKey is MCMUAOILUJVTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S4/c1-2-3(6)4(7)5(8)9/h3-9H,2H2,1H3.
What are the key properties of pentane-1,1,2,3-tetrathiol?
pentane-1,1,2,3-tetrathiol has a molecular weight of 200.42 g/mol, XLogP of 2.18, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,1,2,3-tetrathiol is sourced from PubChem (CID 175001525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).