About 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione
2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione (PubChem CID 175002355) has the molecular formula C17H27NO3S
and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione.
Molecular Properties
| Compound Name | 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione |
| PubChem CID | 175002355 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione |
| SMILES | CC(C)(C)C1CCC(CC(=O)O)CC1.On1ccccc1=S |
| InChI | InChI=1S/C12H22O2.C5H5NOS/c1-12(2,3)10-6-4-9(5-7-10)8-11(13)14;7-6-4-2-1-3-5(6)8/h9-10H,4-8H2,1-3H3,(H,13,14);1-4,7H |
| InChIKey | ULYVENGYTJJZIL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione?
The IUPAC name of 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione (CID 175002355) is 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione.
What is the SMILES notation for 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione?
The canonical SMILES for 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione is CC(C)(C)C1CCC(CC(=O)O)CC1.On1ccccc1=S.
What is the InChIKey of 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione?
The InChIKey is ULYVENGYTJJZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.C5H5NOS/c1-12(2,3)10-6-4-9(5-7-10)8-11(13)14;7-6-4-2-1-3-5(6)8/h9-10H,4-8H2,1-3H3,(H,13,14);1-4,7H.
What are the key properties of 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione?
2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione has a molecular weight of 325.47 g/mol, XLogP of 4.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylcyclohexyl)acetic acid;1-hydroxypyridine-2-thione is sourced from PubChem (CID 175002355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).