About 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane
2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane (PubChem CID 175002711) has the molecular formula C14H26OS4
and a molecular weight of 338.63 g/mol. Its IUPAC name is 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane |
| PubChem CID | 175002711 |
| Molecular Formula | C14H26OS4 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane |
| SMILES | CCC(CC1SCCS1)OC(CC)CC1SCCS1 |
| InChI | InChI=1S/C14H26OS4/c1-3-11(9-13-16-5-6-17-13)15-12(4-2)10-14-18-7-8-19-14/h11-14H,3-10H2,1-2H3 |
| InChIKey | FHFPATNFLKEDLH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane?
The IUPAC name of 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane (CID 175002711) is 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane.
What is the SMILES notation for 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane?
The canonical SMILES for 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane is CCC(CC1SCCS1)OC(CC)CC1SCCS1.
What is the InChIKey of 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane?
The InChIKey is FHFPATNFLKEDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26OS4/c1-3-11(9-13-16-5-6-17-13)15-12(4-2)10-14-18-7-8-19-14/h11-14H,3-10H2,1-2H3.
What are the key properties of 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane?
2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane has a molecular weight of 338.63 g/mol, XLogP of 4.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1-(1,3-dithiolan-2-yl)butan-2-yloxy]butyl]-1,3-dithiolane is sourced from PubChem (CID 175002711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).