C17H21F2NO8S — CID 175003256
(E)-2,3-difluorobut-2-enedioic acid;[5-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 175003256) has the molecular formula C17H21F2NO8S and a molecular weight of 437.42 g/mol. Its IUPAC name is (E)-2,3-difluorobut-2-enedioic acid;[5-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | (E)-2,3-difluorobut-2-enedioic acid;[5-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 175003256 |
| Molecular Formula | C17H21F2NO8S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (E)-2,3-difluorobut-2-enedioic acid;[5-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CO)CCC2CO)cc1.O=C(O)/C(F)=C(\F)C(=O)O |
| InChI | InChI=1S/C13H19NO4S.C4H2F2O4/c1-10-2-6-13(7-3-10)19(17,18)14-11(8-15)4-5-12(14)9-16;5-1(3(7)8)2(6)4(9)10/h2-3,6-7,11-12,15-16H,4-5,8-9H2,1H3;(H,7,8)(H,9,10)/b;2-1+ |
| InChIKey | YCTUQOXMIYPQNS-WLHGVMLRSA-N |
| XLogP | 0.81 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|