About 1,2,2-trimethylazetidin-3-amine;hydroiodide
1,2,2-trimethylazetidin-3-amine;hydroiodide (PubChem CID 175004019) has the molecular formula C6H15IN2
and a molecular weight of 242.10 g/mol. Its IUPAC name is 1,2,2-trimethylazetidin-3-amine;hydroiodide.
Molecular Properties
| Compound Name | 1,2,2-trimethylazetidin-3-amine;hydroiodide |
| PubChem CID | 175004019 |
| Molecular Formula | C6H15IN2 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,2,2-trimethylazetidin-3-amine;hydroiodide |
| SMILES | CN1CC(N)C1(C)C.I |
| InChI | InChI=1S/C6H14N2.HI/c1-6(2)5(7)4-8(6)3;/h5H,4,7H2,1-3H3;1H |
| InChIKey | MYKPGHFATAIUOB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trimethylazetidin-3-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trimethylazetidin-3-amine;hydroiodide?
The IUPAC name of 1,2,2-trimethylazetidin-3-amine;hydroiodide (CID 175004019) is 1,2,2-trimethylazetidin-3-amine;hydroiodide.
What is the SMILES notation for 1,2,2-trimethylazetidin-3-amine;hydroiodide?
The canonical SMILES for 1,2,2-trimethylazetidin-3-amine;hydroiodide is CN1CC(N)C1(C)C.I.
What is the InChIKey of 1,2,2-trimethylazetidin-3-amine;hydroiodide?
The InChIKey is MYKPGHFATAIUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.HI/c1-6(2)5(7)4-8(6)3;/h5H,4,7H2,1-3H3;1H.
What are the key properties of 1,2,2-trimethylazetidin-3-amine;hydroiodide?
1,2,2-trimethylazetidin-3-amine;hydroiodide has a molecular weight of 242.10 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trimethylazetidin-3-amine;hydroiodide is sourced from PubChem (CID 175004019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).