About 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium
1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium (PubChem CID 175004095) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium.
Molecular Properties
| Compound Name | 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium |
| PubChem CID | 175004095 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium |
| SMILES | [S-][NH+]1C=Cc2cccnc21 |
| InChI | InChI=1S/C7H6N2S/c10-9-5-3-6-2-1-4-8-7(6)9/h1-5,9H |
| InChIKey | UNBNCVQJHAIDKS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 17.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium?
The IUPAC name of 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium (CID 175004095) is 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium.
What is the SMILES notation for 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium?
The canonical SMILES for 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium is [S-][NH+]1C=Cc2cccnc21.
What is the InChIKey of 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium?
The InChIKey is UNBNCVQJHAIDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c10-9-5-3-6-2-1-4-8-7(6)9/h1-5,9H.
What are the key properties of 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium?
1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium has a molecular weight of 150.21 g/mol, XLogP of 0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfido-1H-pyrrolo[2,3-b]pyridin-1-ium is sourced from PubChem (CID 175004095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).