About 2,2-dipropylmorpholine;hydrobromide
2,2-dipropylmorpholine;hydrobromide (PubChem CID 175004273) has the molecular formula C10H22BrNO
and a molecular weight of 252.20 g/mol. Its IUPAC name is 2,2-dipropylmorpholine;hydrobromide.
Molecular Properties
| Compound Name | 2,2-dipropylmorpholine;hydrobromide |
| PubChem CID | 175004273 |
| Molecular Formula | C10H22BrNO |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2,2-dipropylmorpholine;hydrobromide |
| SMILES | Br.CCCC1(CCC)CNCCO1 |
| InChI | InChI=1S/C10H21NO.BrH/c1-3-5-10(6-4-2)9-11-7-8-12-10;/h11H,3-9H2,1-2H3;1H |
| InChIKey | SLRLUTKYJVCVDF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dipropylmorpholine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dipropylmorpholine;hydrobromide?
The IUPAC name of 2,2-dipropylmorpholine;hydrobromide (CID 175004273) is 2,2-dipropylmorpholine;hydrobromide.
What is the SMILES notation for 2,2-dipropylmorpholine;hydrobromide?
The canonical SMILES for 2,2-dipropylmorpholine;hydrobromide is Br.CCCC1(CCC)CNCCO1.
What is the InChIKey of 2,2-dipropylmorpholine;hydrobromide?
The InChIKey is SLRLUTKYJVCVDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.BrH/c1-3-5-10(6-4-2)9-11-7-8-12-10;/h11H,3-9H2,1-2H3;1H.
What are the key properties of 2,2-dipropylmorpholine;hydrobromide?
2,2-dipropylmorpholine;hydrobromide has a molecular weight of 252.20 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dipropylmorpholine;hydrobromide is sourced from PubChem (CID 175004273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).