About dodecyl 2,5-dioxopyrrole-1-carboxylate
dodecyl 2,5-dioxopyrrole-1-carboxylate (PubChem CID 175005256) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is dodecyl 2,5-dioxopyrrole-1-carboxylate.
Molecular Properties
| Compound Name | dodecyl 2,5-dioxopyrrole-1-carboxylate |
| PubChem CID | 175005256 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | dodecyl 2,5-dioxopyrrole-1-carboxylate |
| SMILES | CCCCCCCCCCCCOC(=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27NO4/c1-2-3-4-5-6-7-8-9-10-11-14-22-17(21)18-15(19)12-13-16(18)20/h12-13H,2-11,14H2,1H3 |
| InChIKey | VRLGNMFCVGDYBH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dodecyl 2,5-dioxopyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl 2,5-dioxopyrrole-1-carboxylate?
The IUPAC name of dodecyl 2,5-dioxopyrrole-1-carboxylate (CID 175005256) is dodecyl 2,5-dioxopyrrole-1-carboxylate.
What is the SMILES notation for dodecyl 2,5-dioxopyrrole-1-carboxylate?
The canonical SMILES for dodecyl 2,5-dioxopyrrole-1-carboxylate is CCCCCCCCCCCCOC(=O)N1C(=O)C=CC1=O.
What is the InChIKey of dodecyl 2,5-dioxopyrrole-1-carboxylate?
The InChIKey is VRLGNMFCVGDYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO4/c1-2-3-4-5-6-7-8-9-10-11-14-22-17(21)18-15(19)12-13-16(18)20/h12-13H,2-11,14H2,1H3.
What are the key properties of dodecyl 2,5-dioxopyrrole-1-carboxylate?
dodecyl 2,5-dioxopyrrole-1-carboxylate has a molecular weight of 309.41 g/mol, XLogP of 3.97, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl 2,5-dioxopyrrole-1-carboxylate is sourced from PubChem (CID 175005256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).