About 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate
1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 175006851) has the molecular formula C12H22F6O5S3
and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate |
| PubChem CID | 175006851 |
| Molecular Formula | C12H22F6O5S3 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCCCCSCCCCC.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H22S.C2F6O5S2/c1-3-5-7-9-11-10-8-6-4-2;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h3-10H2,1-2H3; |
| InChIKey | IHCZAHBXVMOAOJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The IUPAC name of 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate (CID 175006851) is 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate.
What is the SMILES notation for 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The canonical SMILES for 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate is CCCCCSCCCCC.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The InChIKey is IHCZAHBXVMOAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22S.C2F6O5S2/c1-3-5-7-9-11-10-8-6-4-2;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h3-10H2,1-2H3;.
What are the key properties of 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate?
1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate has a molecular weight of 456.49 g/mol, XLogP of 4.80, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylsulfanylpentane;trifluoromethylsulfonyl trifluoromethanesulfonate is sourced from PubChem (CID 175006851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).