C18H18F2N4O6 — CID 175006926
[(1R,2R)-2-[5-[(2,2-difluoroacetyl)iminocarbamoyl]-1,3-dihydroxyisoindol-2-yl]cyclohexyl] carbamate (PubChem CID 175006926) has the molecular formula C18H18F2N4O6 and a molecular weight of 424.36 g/mol. Its IUPAC name is [(1R,2R)-2-[5-[(2,2-difluoroacetyl)iminocarbamoyl]-1,3-dihydroxyisoindol-2-yl]cyclohexyl] carbamate.
| Compound Name | [(1R,2R)-2-[5-[(2,2-difluoroacetyl)iminocarbamoyl]-1,3-dihydroxyisoindol-2-yl]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175006926 |
| Molecular Formula | C18H18F2N4O6 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [(1R,2R)-2-[5-[(2,2-difluoroacetyl)iminocarbamoyl]-1,3-dihydroxyisoindol-2-yl]cyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCC[C@H]1n1c(O)c2ccc(C(=O)/N=N/C(=O)C(F)F)cc2c1O |
| InChI | InChI=1S/C18H18F2N4O6/c19-13(20)15(26)23-22-14(25)8-5-6-9-10(7-8)17(28)24(16(9)27)11-3-1-2-4-12(11)30-18(21)29/h5-7,11-13,27-28H,1-4H2,(H2,21,29)/b23-22+/t11-,12-/m1/s1 |
| InChIKey | IKPNALDWSYILKO-AYEVHFAESA-N |
| XLogP | 3.02 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|