About carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate
carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate (PubChem CID 175007024) has the molecular formula C16H19F2N5O5S
and a molecular weight of 431.42 g/mol. Its IUPAC name is carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate |
| PubChem CID | 175007024 |
| Molecular Formula | C16H19F2N5O5S |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate |
| SMILES | COc1cc(-c2nnn(CC3CCC(F)(F)CC3)n2)ccc1S(=O)(=O)OC(N)=O |
| InChI | InChI=1S/C16H19F2N5O5S/c1-27-12-8-11(2-3-13(12)29(25,26)28-15(19)24)14-20-22-23(21-14)9-10-4-6-16(17,18)7-5-10/h2-3,8,10H,4-7,9H2,1H3,(H2,19,24) |
| InChIKey | WDIJRFNEDBLESZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate?
The IUPAC name of carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate (CID 175007024) is carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate.
What is the SMILES notation for carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate?
The canonical SMILES for carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate is COc1cc(-c2nnn(CC3CCC(F)(F)CC3)n2)ccc1S(=O)(=O)OC(N)=O.
What is the InChIKey of carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate?
The InChIKey is WDIJRFNEDBLESZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N5O5S/c1-27-12-8-11(2-3-13(12)29(25,26)28-15(19)24)14-20-22-23(21-14)9-10-4-6-16(17,18)7-5-10/h2-3,8,10H,4-7,9H2,1H3,(H2,19,24).
What are the key properties of carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate?
carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate has a molecular weight of 431.42 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl 4-[2-[(4,4-difluorocyclohexyl)methyl]tetrazol-5-yl]-2-methoxybenzenesulfonate is sourced from PubChem (CID 175007024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).