About [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate
[(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate (PubChem CID 175007115) has the molecular formula C7H12F2N2O2
and a molecular weight of 194.18 g/mol. Its IUPAC name is [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate.
Molecular Properties
| Compound Name | [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate |
| PubChem CID | 175007115 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCC(F)(F)[C@H]1N |
| InChI | InChI=1S/C7H12F2N2O2/c8-7(9)3-1-2-4(5(7)10)13-6(11)12/h4-5H,1-3,10H2,(H2,11,12)/t4-,5+/m1/s1 |
| InChIKey | FAGHWOPNZCRIJV-UHNVWZDZSA-N |
| XLogP | 0.60 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate?
The IUPAC name of [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate (CID 175007115) is [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate.
What is the SMILES notation for [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate?
The canonical SMILES for [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate is NC(=O)O[C@@H]1CCCC(F)(F)[C@H]1N.
What is the InChIKey of [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate?
The InChIKey is FAGHWOPNZCRIJV-UHNVWZDZSA-N. The full InChI is InChI=1S/C7H12F2N2O2/c8-7(9)3-1-2-4(5(7)10)13-6(11)12/h4-5H,1-3,10H2,(H2,11,12)/t4-,5+/m1/s1.
What are the key properties of [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate?
[(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate has a molecular weight of 194.18 g/mol, XLogP of 0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-amino-3,3-difluorocyclohexyl] carbamate is sourced from PubChem (CID 175007115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).