About 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride
3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride (PubChem CID 175007137) has the molecular formula C11H21ClN2O2
and a molecular weight of 248.75 g/mol. Its IUPAC name is 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride |
| PubChem CID | 175007137 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCCC[C@H]1N1CCCCOC1=O |
| InChI | InChI=1S/C11H20N2O2.ClH/c12-9-5-1-2-6-10(9)13-7-3-4-8-15-11(13)14;/h9-10H,1-8,12H2;1H/t9-,10-;/m1./s1 |
| InChIKey | XPQGPXYSCPRPEW-DHTOPLTISA-N |
| XLogP | 1.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride?
The IUPAC name of 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride (CID 175007137) is 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride.
What is the SMILES notation for 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride?
The canonical SMILES for 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride is Cl.N[C@@H]1CCCC[C@H]1N1CCCCOC1=O.
What is the InChIKey of 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride?
The InChIKey is XPQGPXYSCPRPEW-DHTOPLTISA-N. The full InChI is InChI=1S/C11H20N2O2.ClH/c12-9-5-1-2-6-10(9)13-7-3-4-8-15-11(13)14;/h9-10H,1-8,12H2;1H/t9-,10-;/m1./s1.
What are the key properties of 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride?
3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride has a molecular weight of 248.75 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-aminocyclohexyl]-1,3-oxazepan-2-one;hydrochloride is sourced from PubChem (CID 175007137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).