About 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid
3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175007235) has the molecular formula C10H16F3NO6S2
and a molecular weight of 367.37 g/mol. Its IUPAC name is 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid |
| PubChem CID | 175007235 |
| Molecular Formula | C10H16F3NO6S2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CC1=CC=CN(CCCS(=O)(=O)O)C1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H15NO3S.CHF3O3S/c1-9-4-2-5-10(8-9)6-3-7-14(11,12)13;2-1(3,4)8(5,6)7/h2,4-5H,3,6-8H2,1H3,(H,11,12,13);(H,5,6,7) |
| InChIKey | YDTMNLLYUMIARY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid?
The IUPAC name of 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid (CID 175007235) is 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid?
The canonical SMILES for 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid is CC1=CC=CN(CCCS(=O)(=O)O)C1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid?
The InChIKey is YDTMNLLYUMIARY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S.CHF3O3S/c1-9-4-2-5-10(8-9)6-3-7-14(11,12)13;2-1(3,4)8(5,6)7/h2,4-5H,3,6-8H2,1H3,(H,11,12,13);(H,5,6,7).
What are the key properties of 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid?
3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid has a molecular weight of 367.37 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2H-pyridin-1-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 175007235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).