C22H25ClN4O4 — CID 175007541
8-[2-[3-chloro-4-(oxan-4-yloxy)phenyl]ethenyl]-1,3-diethyl-7H-purine-2,6-dione (PubChem CID 175007541) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is 8-[2-[3-chloro-4-(oxan-4-yloxy)phenyl]ethenyl]-1,3-diethyl-7H-purine-2,6-dione.
| Compound Name | 8-[2-[3-chloro-4-(oxan-4-yloxy)phenyl]ethenyl]-1,3-diethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 175007541 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 8-[2-[3-chloro-4-(oxan-4-yloxy)phenyl]ethenyl]-1,3-diethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)c2[nH]c(C=Cc3ccc(OC4CCOCC4)c(Cl)c3)nc2n(CC)c1=O |
| InChI | InChI=1S/C22H25ClN4O4/c1-3-26-20-19(21(28)27(4-2)22(26)29)24-18(25-20)8-6-14-5-7-17(16(23)13-14)31-15-9-11-30-12-10-15/h5-8,13,15H,3-4,9-12H2,1-2H3,(H,24,25) |
| InChIKey | NDUNJMQLQVFDDX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |