About furan;5-phenylfuran-2-carbaldehyde
furan;5-phenylfuran-2-carbaldehyde (PubChem CID 175007564) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is furan;5-phenylfuran-2-carbaldehyde.
Molecular Properties
| Compound Name | furan;5-phenylfuran-2-carbaldehyde |
| PubChem CID | 175007564 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | furan;5-phenylfuran-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2)o1.c1ccoc1 |
| InChI | InChI=1S/C11H8O2.C4H4O/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9;1-2-4-5-3-1/h1-8H;1-4H |
| InChIKey | IWKXLMVYXURLBL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze furan;5-phenylfuran-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;5-phenylfuran-2-carbaldehyde?
The IUPAC name of furan;5-phenylfuran-2-carbaldehyde (CID 175007564) is furan;5-phenylfuran-2-carbaldehyde.
What is the SMILES notation for furan;5-phenylfuran-2-carbaldehyde?
The canonical SMILES for furan;5-phenylfuran-2-carbaldehyde is O=Cc1ccc(-c2ccccc2)o1.c1ccoc1.
What is the InChIKey of furan;5-phenylfuran-2-carbaldehyde?
The InChIKey is IWKXLMVYXURLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C4H4O/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9;1-2-4-5-3-1/h1-8H;1-4H.
What are the key properties of furan;5-phenylfuran-2-carbaldehyde?
furan;5-phenylfuran-2-carbaldehyde has a molecular weight of 240.26 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan;5-phenylfuran-2-carbaldehyde is sourced from PubChem (CID 175007564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).