C13H9F21OSi — CID 175007606
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluoro-2-methyldodecan-2-yl)oxysilane (PubChem CID 175007606) has the molecular formula C13H9F21OSi and a molecular weight of 608.26 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluoro-2-methyldodecan-2-yl)oxysilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluoro-2-methyldodecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175007606 |
| Molecular Formula | C13H9F21OSi |
| Molecular Weight | 608.26 g/mol |
| Exact Mass | 608.01 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluoro-2-methyldodecan-2-yl)oxysilane |
| SMILES | CC(C)(O[SiH3])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F21OSi/c1-3(2,35-36)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)12(30,31)13(32,33)34/h1-2,36H3 |
| InChIKey | CAXXJRCVQJYVNM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.26 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|