About 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane
1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane (PubChem CID 175007738) has the molecular formula C25H50O4
and a molecular weight of 414.67 g/mol. Its IUPAC name is 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane.
Molecular Properties
| Compound Name | 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane |
| PubChem CID | 175007738 |
| Molecular Formula | C25H50O4 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane |
| SMILES | CCC(C)(C)CCCCC#COOC(C)(C)C.CCC(C)(C)OOC(C)(C)CC |
| InChI | InChI=1S/C15H28O2.C10H22O2/c1-7-15(5,6)12-10-8-9-11-13-16-17-14(2,3)4;1-7-9(3,4)11-12-10(5,6)8-2/h7-10,12H2,1-6H3;7-8H2,1-6H3 |
| InChIKey | SOUMEECSXYCAFN-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane?
The IUPAC name of 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane (CID 175007738) is 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane.
What is the SMILES notation for 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane?
The canonical SMILES for 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane is CCC(C)(C)CCCCC#COOC(C)(C)C.CCC(C)(C)OOC(C)(C)CC.
What is the InChIKey of 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane?
The InChIKey is SOUMEECSXYCAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2.C10H22O2/c1-7-15(5,6)12-10-8-9-11-13-16-17-14(2,3)4;1-7-9(3,4)11-12-10(5,6)8-2/h7-10,12H2,1-6H3;7-8H2,1-6H3.
What are the key properties of 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane?
1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane has a molecular weight of 414.67 g/mol, XLogP of 8.00, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylperoxy-7,7-dimethylnon-1-yne;2-methyl-2-(2-methylbutan-2-ylperoxy)butane is sourced from PubChem (CID 175007738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).