About [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate
[(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate (PubChem CID 175007792) has the molecular formula C10H16N2O4
and a molecular weight of 228.25 g/mol. Its IUPAC name is [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate.
Molecular Properties
| Compound Name | [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate |
| PubChem CID | 175007792 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCC[C@H]1N1CCOC1=O |
| InChI | InChI=1S/C10H16N2O4/c11-9(13)16-8-4-2-1-3-7(8)12-5-6-15-10(12)14/h7-8H,1-6H2,(H2,11,13)/t7-,8-/m1/s1 |
| InChIKey | BVCDJXAIHWDMIK-HTQZYQBOSA-N |
| XLogP | 0.85 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate?
The IUPAC name of [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate (CID 175007792) is [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate.
What is the SMILES notation for [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate?
The canonical SMILES for [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate is NC(=O)O[C@@H]1CCCC[C@H]1N1CCOC1=O.
What is the InChIKey of [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate?
The InChIKey is BVCDJXAIHWDMIK-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H16N2O4/c11-9(13)16-8-4-2-1-3-7(8)12-5-6-15-10(12)14/h7-8H,1-6H2,(H2,11,13)/t7-,8-/m1/s1.
What are the key properties of [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate?
[(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate has a molecular weight of 228.25 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(2-oxo-1,3-oxazolidin-3-yl)cyclohexyl] carbamate is sourced from PubChem (CID 175007792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).