About (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide
(6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide (PubChem CID 175008079) has the molecular formula C7H12BrN3O3
and a molecular weight of 266.10 g/mol. Its IUPAC name is (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide.
Molecular Properties
| Compound Name | (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide |
| PubChem CID | 175008079 |
| Molecular Formula | C7H12BrN3O3 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide |
| SMILES | Br.COC1([N+](=O)[O-])C=CC=CC1NN |
| InChI | InChI=1S/C7H11N3O3.BrH/c1-13-7(10(11)12)5-3-2-4-6(7)9-8;/h2-6,9H,8H2,1H3;1H |
| InChIKey | SWQGZJPWVFGIHF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide?
The IUPAC name of (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide (CID 175008079) is (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide.
What is the SMILES notation for (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide?
The canonical SMILES for (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide is Br.COC1([N+](=O)[O-])C=CC=CC1NN.
What is the InChIKey of (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide?
The InChIKey is SWQGZJPWVFGIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3.BrH/c1-13-7(10(11)12)5-3-2-4-6(7)9-8;/h2-6,9H,8H2,1H3;1H.
What are the key properties of (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide?
(6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide has a molecular weight of 266.10 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-6-nitrocyclohexa-2,4-dien-1-yl)hydrazine;hydrobromide is sourced from PubChem (CID 175008079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).