C23H23Cl2N5O3 — CID 175009157
N-[5-(2,2-dichloro-1,3-benzodioxol-4-yl)-1H-pyrazol-3-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide (PubChem CID 175009157) has the molecular formula C23H23Cl2N5O3 and a molecular weight of 488.38 g/mol. Its IUPAC name is N-[5-(2,2-dichloro-1,3-benzodioxol-4-yl)-1H-pyrazol-3-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide.
| Compound Name | N-[5-(2,2-dichloro-1,3-benzodioxol-4-yl)-1H-pyrazol-3-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 175009157 |
| Molecular Formula | C23H23Cl2N5O3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[5-(2,2-dichloro-1,3-benzodioxol-4-yl)-1H-pyrazol-3-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide |
| SMILES | CN1CCC(Nc2ccc(C(=O)Nc3cc(-c4cccc5c4OC(Cl)(Cl)O5)[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C23H23Cl2N5O3/c1-30-11-9-16(10-12-30)26-15-7-5-14(6-8-15)22(31)27-20-13-18(28-29-20)17-3-2-4-19-21(17)33-23(24,25)32-19/h2-8,13,16,26H,9-12H2,1H3,(H2,27,28,29,31) |
| InChIKey | ZFASZVIILNQZGS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|