C17H12F4O6 — CID 175010302
2-fluoro-3-formyl-6-[[2-methoxy-4-(trifluoromethoxy)phenoxy]methyl]benzoic acid (PubChem CID 175010302) has the molecular formula C17H12F4O6 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-fluoro-3-formyl-6-[[2-methoxy-4-(trifluoromethoxy)phenoxy]methyl]benzoic acid.
| Compound Name | 2-fluoro-3-formyl-6-[[2-methoxy-4-(trifluoromethoxy)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 175010302 |
| Molecular Formula | C17H12F4O6 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-fluoro-3-formyl-6-[[2-methoxy-4-(trifluoromethoxy)phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(OC(F)(F)F)ccc1OCc1ccc(C=O)c(F)c1C(=O)O |
| InChI | InChI=1S/C17H12F4O6/c1-25-13-6-11(27-17(19,20)21)4-5-12(13)26-8-10-3-2-9(7-22)15(18)14(10)16(23)24/h2-7H,8H2,1H3,(H,23,24) |
| InChIKey | DHLPHMPBPLYENA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|