C6H7NO4S2 — CID 175010618
4-aminobenzene-1,3-disulfinic acid (PubChem CID 175010618) has the molecular formula C6H7NO4S2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-aminobenzene-1,3-disulfinic acid.
| Compound Name | 4-aminobenzene-1,3-disulfinic acid |
|---|---|
| PubChem CID | 175010618 |
| Molecular Formula | C6H7NO4S2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 4-aminobenzene-1,3-disulfinic acid |
| SMILES | Nc1ccc(S(=O)O)cc1S(=O)O |
| InChI | InChI=1S/C6H7NO4S2/c7-5-2-1-4(12(8)9)3-6(5)13(10)11/h1-3H,7H2,(H,8,9)(H,10,11) |
| InChIKey | FPVSTGPEALAEHI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|