About adamantane;triazine
adamantane;triazine (PubChem CID 175011853) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is adamantane;triazine.
Molecular Properties
| Compound Name | adamantane;triazine |
| PubChem CID | 175011853 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | adamantane;triazine |
| SMILES | C1C2CC3CC1CC(C2)C3.c1cnnnc1 |
| InChI | InChI=1S/C10H16.C3H3N3/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-6-5-3-1/h7-10H,1-6H2;1-3H |
| InChIKey | UETUMPJUNICPMN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze adamantane;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;triazine?
The IUPAC name of adamantane;triazine (CID 175011853) is adamantane;triazine.
What is the SMILES notation for adamantane;triazine?
The canonical SMILES for adamantane;triazine is C1C2CC3CC1CC(C2)C3.c1cnnnc1.
What is the InChIKey of adamantane;triazine?
The InChIKey is UETUMPJUNICPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C3H3N3/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-6-5-3-1/h7-10H,1-6H2;1-3H.
What are the key properties of adamantane;triazine?
adamantane;triazine has a molecular weight of 217.32 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;triazine is sourced from PubChem (CID 175011853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).