About isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone
isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone (PubChem CID 175012058) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone.
Molecular Properties
| Compound Name | isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone |
| PubChem CID | 175012058 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone |
| SMILES | O=C(c1nccc2ccccc12)C1NCCO1 |
| InChI | InChI=1S/C13H12N2O2/c16-12(13-15-7-8-17-13)11-10-4-2-1-3-9(10)5-6-14-11/h1-6,13,15H,7-8H2 |
| InChIKey | BMLCDXAKDGVWDN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone?
The IUPAC name of isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone (CID 175012058) is isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone.
What is the SMILES notation for isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone?
The canonical SMILES for isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone is O=C(c1nccc2ccccc12)C1NCCO1.
What is the InChIKey of isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone?
The InChIKey is BMLCDXAKDGVWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c16-12(13-15-7-8-17-13)11-10-4-2-1-3-9(10)5-6-14-11/h1-6,13,15H,7-8H2.
What are the key properties of isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone?
isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone has a molecular weight of 228.25 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-1-yl(1,3-oxazolidin-2-yl)methanone is sourced from PubChem (CID 175012058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).