About 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate (PubChem CID 175012519) has the molecular formula C15H30O6
and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate.
Molecular Properties
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate |
| PubChem CID | 175012519 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate |
| SMILES | CCC(CO)(CO)CO.CCCOOC(=O)C(C)=C(C)C |
| InChI | InChI=1S/C9H16O3.C6H14O3/c1-5-6-11-12-9(10)8(4)7(2)3;1-2-6(3-7,4-8)5-9/h5-6H2,1-4H3;7-9H,2-5H2,1H3 |
| InChIKey | VTCFQMTUFACAOQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate?
The IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate (CID 175012519) is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate.
What is the SMILES notation for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate?
The canonical SMILES for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate is CCC(CO)(CO)CO.CCCOOC(=O)C(C)=C(C)C.
What is the InChIKey of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate?
The InChIKey is VTCFQMTUFACAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3.C6H14O3/c1-5-6-11-12-9(10)8(4)7(2)3;1-2-6(3-7,4-8)5-9/h5-6H2,1-4H3;7-9H,2-5H2,1H3.
What are the key properties of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate?
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate has a molecular weight of 306.40 g/mol, XLogP of 1.59, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;propyl 2,3-dimethylbut-2-eneperoxoate is sourced from PubChem (CID 175012519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).