C27H31N5O4 — CID 175012545
2-[2-[(2R,3R,4R)-2,4-diamino-10-[(3R)-3-aminopiperidine-1-carbonyl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-yl]indol-1-yl]acetic acid (PubChem CID 175012545) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[2-[(2R,3R,4R)-2,4-diamino-10-[(3R)-3-aminopiperidine-1-carbonyl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-yl]indol-1-yl]acetic acid.
| Compound Name | 2-[2-[(2R,3R,4R)-2,4-diamino-10-[(3R)-3-aminopiperidine-1-carbonyl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-yl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 175012545 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[2-[(2R,3R,4R)-2,4-diamino-10-[(3R)-3-aminopiperidine-1-carbonyl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-yl]indol-1-yl]acetic acid |
| SMILES | N[C@@H]1CCCN(C(=O)c2cc3c4c(c2)[C@H](N)[C@@H](c2cc5ccccc5n2CC(=O)O)[C@]4(N)CCO3)C1 |
| InChI | InChI=1S/C27H31N5O4/c28-17-5-3-8-31(13-17)26(35)16-10-18-23-21(12-16)36-9-7-27(23,30)24(25(18)29)20-11-15-4-1-2-6-19(15)32(20)14-22(33)34/h1-2,4,6,10-12,17,24-25H,3,5,7-9,13-14,28-30H2,(H,33,34)/t17-,24-,25+,27+/m1/s1 |
| InChIKey | CTVKYPGUYRMXFB-YZAQAPLFSA-N |
| XLogP | 2.02 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |