C11H6F16O — CID 175012727
2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane (PubChem CID 175012727) has the molecular formula C11H6F16O and a molecular weight of 458.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane |
|---|---|
| PubChem CID | 175012727 |
| Molecular Formula | C11H6F16O |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(C(F)(F)C(F)(F)C(F)(F)F)CCCO1 |
| InChI | InChI=1S/C11H6F16O/c12-5(13,7(16,17)9(20,21)11(25,26)27)4(2-1-3-28-4)6(14,15)8(18,19)10(22,23)24/h1-3H2 |
| InChIKey | RHEPBJNFPFYYPJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|