About ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate
ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate (PubChem CID 175013002) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate |
| PubChem CID | 175013002 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate |
| SMILES | CCC=CC1(CC(NC(C)=O)C(=O)OCC)C=CC(O)=CC1 |
| InChI | InChI=1S/C17H25NO4/c1-4-6-9-17(10-7-14(20)8-11-17)12-15(18-13(3)19)16(21)22-5-2/h6-10,15,20H,4-5,11-12H2,1-3H3,(H,18,19) |
| InChIKey | JIGCUZWSUGBSMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate?
The IUPAC name of ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate (CID 175013002) is ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate.
What is the SMILES notation for ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate?
The canonical SMILES for ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate is CCC=CC1(CC(NC(C)=O)C(=O)OCC)C=CC(O)=CC1.
What is the InChIKey of ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate?
The InChIKey is JIGCUZWSUGBSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-4-6-9-17(10-7-14(20)8-11-17)12-15(18-13(3)19)16(21)22-5-2/h6-10,15,20H,4-5,11-12H2,1-3H3,(H,18,19).
What are the key properties of ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate?
ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate has a molecular weight of 307.39 g/mol, XLogP of 2.80, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetamido-3-(1-but-1-enyl-4-hydroxycyclohexa-2,4-dien-1-yl)propanoate is sourced from PubChem (CID 175013002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).