About N-acetylacetamide;azane
N-acetylacetamide;azane (PubChem CID 175013132) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is N-acetylacetamide;azane.
Molecular Properties
| Compound Name | N-acetylacetamide;azane |
| PubChem CID | 175013132 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | N-acetylacetamide;azane |
| SMILES | CC(=O)NC(C)=O.N |
| InChI | InChI=1S/C4H7NO2.H3N/c1-3(6)5-4(2)7;/h1-2H3,(H,5,6,7);1H3 |
| InChIKey | QVQPADQDDGSUFJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-acetylacetamide;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylacetamide;azane?
The IUPAC name of N-acetylacetamide;azane (CID 175013132) is N-acetylacetamide;azane.
What is the SMILES notation for N-acetylacetamide;azane?
The canonical SMILES for N-acetylacetamide;azane is CC(=O)NC(C)=O.N.
What is the InChIKey of N-acetylacetamide;azane?
The InChIKey is QVQPADQDDGSUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H3N/c1-3(6)5-4(2)7;/h1-2H3,(H,5,6,7);1H3.
What are the key properties of N-acetylacetamide;azane?
N-acetylacetamide;azane has a molecular weight of 118.14 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylacetamide;azane is sourced from PubChem (CID 175013132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).