About 1,5-dimethylcyclopenta-1,3-diene;platinum
1,5-dimethylcyclopenta-1,3-diene;platinum (PubChem CID 175013405) has the molecular formula C7H9Pt-
and a molecular weight of 288.23 g/mol. Its IUPAC name is 1,5-dimethylcyclopenta-1,3-diene;platinum.
Molecular Properties
| Compound Name | 1,5-dimethylcyclopenta-1,3-diene;platinum |
| PubChem CID | 175013405 |
| Molecular Formula | C7H9Pt- |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,5-dimethylcyclopenta-1,3-diene;platinum |
| SMILES | CC1=[C-]C=CC1C.[Pt] |
| InChI | InChI=1S/C7H9.Pt/c1-6-4-3-5-7(6)2;/h3-4,6H,1-2H3;/q-1; |
| InChIKey | GLGODZYDXBRELE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethylcyclopenta-1,3-diene;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylcyclopenta-1,3-diene;platinum?
The IUPAC name of 1,5-dimethylcyclopenta-1,3-diene;platinum (CID 175013405) is 1,5-dimethylcyclopenta-1,3-diene;platinum.
What is the SMILES notation for 1,5-dimethylcyclopenta-1,3-diene;platinum?
The canonical SMILES for 1,5-dimethylcyclopenta-1,3-diene;platinum is CC1=[C-]C=CC1C.[Pt].
What is the InChIKey of 1,5-dimethylcyclopenta-1,3-diene;platinum?
The InChIKey is GLGODZYDXBRELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.Pt/c1-6-4-3-5-7(6)2;/h3-4,6H,1-2H3;/q-1;.
What are the key properties of 1,5-dimethylcyclopenta-1,3-diene;platinum?
1,5-dimethylcyclopenta-1,3-diene;platinum has a molecular weight of 288.23 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylcyclopenta-1,3-diene;platinum is sourced from PubChem (CID 175013405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).