About [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate
[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate (PubChem CID 175013466) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate.
Molecular Properties
| Compound Name | [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate |
| PubChem CID | 175013466 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate |
| SMILES | CC1(C)OC[C@@H](COc2ccnc(OC(N)=O)n2)O1 |
| InChI | InChI=1S/C11H15N3O5/c1-11(2)17-6-7(19-11)5-16-8-3-4-13-10(14-8)18-9(12)15/h3-4,7H,5-6H2,1-2H3,(H2,12,15)/t7-/m1/s1 |
| InChIKey | VEPFAYWHBRASLC-SSDOTTSWSA-N |
| XLogP | 0.46 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate?
The IUPAC name of [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate (CID 175013466) is [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate.
What is the SMILES notation for [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate?
The canonical SMILES for [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate is CC1(C)OC[C@@H](COc2ccnc(OC(N)=O)n2)O1.
What is the InChIKey of [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate?
The InChIKey is VEPFAYWHBRASLC-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15N3O5/c1-11(2)17-6-7(19-11)5-16-8-3-4-13-10(14-8)18-9(12)15/h3-4,7H,5-6H2,1-2H3,(H2,12,15)/t7-/m1/s1.
What are the key properties of [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate?
[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate has a molecular weight of 269.26 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrimidin-2-yl] carbamate is sourced from PubChem (CID 175013466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).