About 1,2-dibromo-1,3,3-trifluoroprop-1-ene
1,2-dibromo-1,3,3-trifluoroprop-1-ene (PubChem CID 175013473) has the molecular formula C3HBr2F3
and a molecular weight of 253.84 g/mol. Its IUPAC name is 1,2-dibromo-1,3,3-trifluoroprop-1-ene.
Molecular Properties
| Compound Name | 1,2-dibromo-1,3,3-trifluoroprop-1-ene |
| PubChem CID | 175013473 |
| Molecular Formula | C3HBr2F3 |
| Molecular Weight | 253.84 g/mol |
| Exact Mass | 251.84 |
| IUPAC Name | 1,2-dibromo-1,3,3-trifluoroprop-1-ene |
| SMILES | FC(Br)=C(Br)C(F)F |
| InChI | InChI=1S/C3HBr2F3/c4-1(2(5)6)3(7)8/h3H |
| InChIKey | LAPDWISRYAVNIZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dibromo-1,3,3-trifluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromo-1,3,3-trifluoroprop-1-ene?
The IUPAC name of 1,2-dibromo-1,3,3-trifluoroprop-1-ene (CID 175013473) is 1,2-dibromo-1,3,3-trifluoroprop-1-ene.
What is the SMILES notation for 1,2-dibromo-1,3,3-trifluoroprop-1-ene?
The canonical SMILES for 1,2-dibromo-1,3,3-trifluoroprop-1-ene is FC(Br)=C(Br)C(F)F.
What is the InChIKey of 1,2-dibromo-1,3,3-trifluoroprop-1-ene?
The InChIKey is LAPDWISRYAVNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HBr2F3/c4-1(2(5)6)3(7)8/h3H.
What are the key properties of 1,2-dibromo-1,3,3-trifluoroprop-1-ene?
1,2-dibromo-1,3,3-trifluoroprop-1-ene has a molecular weight of 253.84 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromo-1,3,3-trifluoroprop-1-ene is sourced from PubChem (CID 175013473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).