C19H39F3O3Si — CID 175013519
diethoxy-ethyl-[1,1,1-trifluoro-5-methyl-3,4-di(propan-2-yl)hexan-3-yl]oxysilane (PubChem CID 175013519) has the molecular formula C19H39F3O3Si and a molecular weight of 400.60 g/mol. Its IUPAC name is diethoxy-ethyl-[1,1,1-trifluoro-5-methyl-3,4-di(propan-2-yl)hexan-3-yl]oxysilane.
| Compound Name | diethoxy-ethyl-[1,1,1-trifluoro-5-methyl-3,4-di(propan-2-yl)hexan-3-yl]oxysilane |
|---|---|
| PubChem CID | 175013519 |
| Molecular Formula | C19H39F3O3Si |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | diethoxy-ethyl-[1,1,1-trifluoro-5-methyl-3,4-di(propan-2-yl)hexan-3-yl]oxysilane |
| SMILES | CCO[Si](CC)(OCC)OC(CC(F)(F)F)(C(C)C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C19H39F3O3Si/c1-10-23-26(12-3,24-11-2)25-18(16(8)9,13-19(20,21)22)17(14(4)5)15(6)7/h14-17H,10-13H2,1-9H3 |
| InChIKey | IVMFKYYSAQUCCK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|