C17H25F13O3Si — CID 175013915
triethoxy-(1,2,2,3,3,4,5,6,7,8,9,10,10-tridecafluoro-4-methyldecyl)silane (PubChem CID 175013915) has the molecular formula C17H25F13O3Si and a molecular weight of 552.44 g/mol. Its IUPAC name is triethoxy-(1,2,2,3,3,4,5,6,7,8,9,10,10-tridecafluoro-4-methyldecyl)silane.
| Compound Name | triethoxy-(1,2,2,3,3,4,5,6,7,8,9,10,10-tridecafluoro-4-methyldecyl)silane |
|---|---|
| PubChem CID | 175013915 |
| Molecular Formula | C17H25F13O3Si |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | triethoxy-(1,2,2,3,3,4,5,6,7,8,9,10,10-tridecafluoro-4-methyldecyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)C(F)(F)C(F)(F)C(C)(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C17H25F13O3Si/c1-5-31-34(32-6-2,33-7-3)14(25)16(27,28)17(29,30)15(4,26)12(22)10(20)8(18)9(19)11(21)13(23)24/h8-14H,5-7H2,1-4H3 |
| InChIKey | DSBMIWANYUFDIO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|