About (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide
(4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide (PubChem CID 175014333) has the molecular formula C8H14BrN3O4
and a molecular weight of 296.12 g/mol. Its IUPAC name is (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide.
Molecular Properties
| Compound Name | (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide |
| PubChem CID | 175014333 |
| Molecular Formula | C8H14BrN3O4 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide |
| SMILES | Br.C=CC(=O)N(N)C(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C8H13N3O4.BrH/c1-2-6(12)11(10)8(15)5(9)3-4-7(13)14;/h2,5H,1,3-4,9-10H2,(H,13,14);1H/t5-;/m0./s1 |
| InChIKey | DREOHRKHGMSIFU-JEDNCBNOSA-N |
| XLogP | -0.83 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide?
The IUPAC name of (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide (CID 175014333) is (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide.
What is the SMILES notation for (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide?
The canonical SMILES for (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide is Br.C=CC(=O)N(N)C(=O)[C@@H](N)CCC(=O)O.
What is the InChIKey of (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide?
The InChIKey is DREOHRKHGMSIFU-JEDNCBNOSA-N. The full InChI is InChI=1S/C8H13N3O4.BrH/c1-2-6(12)11(10)8(15)5(9)3-4-7(13)14;/h2,5H,1,3-4,9-10H2,(H,13,14);1H/t5-;/m0./s1.
What are the key properties of (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide?
(4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide has a molecular weight of 296.12 g/mol, XLogP of -0.83, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-5-[amino(prop-2-enoyl)amino]-5-oxopentanoic acid;hydrobromide is sourced from PubChem (CID 175014333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).