C9H14F6O8S2 — CID 175014892
1,1,1,6,6,6-hexafluoro-3-hydroxy-3-(2-hydroxyethyl)-2-methylhexane-2,5-disulfonic acid (PubChem CID 175014892) has the molecular formula C9H14F6O8S2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexafluoro-3-hydroxy-3-(2-hydroxyethyl)-2-methylhexane-2,5-disulfonic acid.
| Compound Name | 1,1,1,6,6,6-hexafluoro-3-hydroxy-3-(2-hydroxyethyl)-2-methylhexane-2,5-disulfonic acid |
|---|---|
| PubChem CID | 175014892 |
| Molecular Formula | C9H14F6O8S2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 1,1,1,6,6,6-hexafluoro-3-hydroxy-3-(2-hydroxyethyl)-2-methylhexane-2,5-disulfonic acid |
| SMILES | CC(C(F)(F)F)(C(O)(CCO)CC(C(F)(F)F)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C9H14F6O8S2/c1-6(9(13,14)15,25(21,22)23)7(17,2-3-16)4-5(8(10,11)12)24(18,19)20/h5,16-17H,2-4H2,1H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | IFKNWCUNPPEFPE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|