About sodium;cyclohexanimine;chloride
sodium;cyclohexanimine;chloride (PubChem CID 175015859) has the molecular formula C6H11ClNNa
and a molecular weight of 155.60 g/mol. Its IUPAC name is sodium;cyclohexanimine;chloride.
Molecular Properties
| Compound Name | sodium;cyclohexanimine;chloride |
| PubChem CID | 175015859 |
| Molecular Formula | C6H11ClNNa |
| Molecular Weight | 155.60 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | sodium;cyclohexanimine;chloride |
| SMILES | [Cl-].[H]N=C1CCCCC1.[Na+] |
| InChI | InChI=1S/C6H11N.ClH.Na/c7-6-4-2-1-3-5-6;;/h7H,1-5H2;1H;/q;;+1/p-1 |
| InChIKey | NGEFLPDIYIPXRQ-UHFFFAOYSA-M |
| XLogP | -4.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.60 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;cyclohexanimine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;cyclohexanimine;chloride?
The IUPAC name of sodium;cyclohexanimine;chloride (CID 175015859) is sodium;cyclohexanimine;chloride.
What is the SMILES notation for sodium;cyclohexanimine;chloride?
The canonical SMILES for sodium;cyclohexanimine;chloride is [Cl-].[H]N=C1CCCCC1.[Na+].
What is the InChIKey of sodium;cyclohexanimine;chloride?
The InChIKey is NGEFLPDIYIPXRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N.ClH.Na/c7-6-4-2-1-3-5-6;;/h7H,1-5H2;1H;/q;;+1/p-1.
What are the key properties of sodium;cyclohexanimine;chloride?
sodium;cyclohexanimine;chloride has a molecular weight of 155.60 g/mol, XLogP of -4.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;cyclohexanimine;chloride is sourced from PubChem (CID 175015859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).