About 4H-quinazoline-3,8-diamine
4H-quinazoline-3,8-diamine (PubChem CID 175015962) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 4H-quinazoline-3,8-diamine.
Molecular Properties
| Compound Name | 4H-quinazoline-3,8-diamine |
| PubChem CID | 175015962 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4H-quinazoline-3,8-diamine |
| SMILES | Nc1cccc2c1N=CN(N)C2 |
| InChI | InChI=1S/C8H10N4/c9-7-3-1-2-6-4-12(10)5-11-8(6)7/h1-3,5H,4,9-10H2 |
| InChIKey | GXKBFKHOXJHWGS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4H-quinazoline-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-quinazoline-3,8-diamine?
The IUPAC name of 4H-quinazoline-3,8-diamine (CID 175015962) is 4H-quinazoline-3,8-diamine.
What is the SMILES notation for 4H-quinazoline-3,8-diamine?
The canonical SMILES for 4H-quinazoline-3,8-diamine is Nc1cccc2c1N=CN(N)C2.
What is the InChIKey of 4H-quinazoline-3,8-diamine?
The InChIKey is GXKBFKHOXJHWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c9-7-3-1-2-6-4-12(10)5-11-8(6)7/h1-3,5H,4,9-10H2.
What are the key properties of 4H-quinazoline-3,8-diamine?
4H-quinazoline-3,8-diamine has a molecular weight of 162.20 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-quinazoline-3,8-diamine is sourced from PubChem (CID 175015962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).