About CID 175016122
CID 175016122 (PubChem CID 175016122) has the molecular formula C19H23N4O5S-
and a molecular weight of 419.48 g/mol.
Molecular Properties
| Compound Name | CID 175016122 |
| PubChem CID | 175016122 |
| Molecular Formula | C19H23N4O5S- |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cn(C)c(=O)c3[nH]ccc23)c(OC2CCOC2)nc1C.NS(=O)[O-] |
| InChI | InChI=1S/C19H21N3O3.H3NO2S/c1-11-8-15(18(21-12(11)2)25-13-5-7-24-10-13)16-9-22(3)19(23)17-14(16)4-6-20-17;1-4(2)3/h4,6,8-9,13,20H,5,7,10H2,1-3H3;1H2,(H,2,3)/p-1 |
| InChIKey | CCNALLKNNMVABY-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 175016122 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175016122?
The IUPAC name of CID 175016122 (CID 175016122) is not available.
What is the SMILES notation for CID 175016122?
The canonical SMILES for CID 175016122 is Cc1cc(-c2cn(C)c(=O)c3[nH]ccc23)c(OC2CCOC2)nc1C.NS(=O)[O-].
What is the InChIKey of CID 175016122?
The InChIKey is CCNALLKNNMVABY-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21N3O3.H3NO2S/c1-11-8-15(18(21-12(11)2)25-13-5-7-24-10-13)16-9-22(3)19(23)17-14(16)4-6-20-17;1-4(2)3/h4,6,8-9,13,20H,5,7,10H2,1-3H3;1H2,(H,2,3)/p-1.
What are the key properties of CID 175016122?
CID 175016122 has a molecular weight of 419.48 g/mol, XLogP of 1.45, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175016122 is sourced from PubChem (CID 175016122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).