2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid

C21H16N2O2 — CID 175016259

IUPAC2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1c(-c2ccccc2)nc2cc(-c3ccccc3)ccn12
InChIInChI=1S/C21H16N2O2/c24-20(25)14-18-21(16-9-5-2-6-10-16)22-19-13-17(11-12-23(18)19)15-7-3-1-4-8-15/h1-13H,14H2,(H,24,25)
InChIKeyXDLIDQIMVNZSII-UHFFFAOYSA-N
MW328.37 g/mol
LogP4.30
Rot. Bonds4

About 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid

2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid (PubChem CID 175016259) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid
PubChem CID175016259
Molecular FormulaC21H16N2O2
Molecular Weight328.37 g/mol
Exact Mass328.12
IUPAC Name2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1c(-c2ccccc2)nc2cc(-c3ccccc3)ccn12
InChIInChI=1S/C21H16N2O2/c24-20(25)14-18-21(16-9-5-2-6-10-16)22-19-13-17(11-12-23(18)19)15-7-3-1-4-8-15/h1-13H,14H2,(H,24,25)
InChIKeyXDLIDQIMVNZSII-UHFFFAOYSA-N
XLogP4.30
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.37
LogP ≤ 54.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid (CID 175016259) is 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid is O=C(O)Cc1c(-c2ccccc2)nc2cc(-c3ccccc3)ccn12.
What is the InChIKey of 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid?
The InChIKey is XDLIDQIMVNZSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c24-20(25)14-18-21(16-9-5-2-6-10-16)22-19-13-17(11-12-23(18)19)15-7-3-1-4-8-15/h1-13H,14H2,(H,24,25).
What are the key properties of 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid?
2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid has a molecular weight of 328.37 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,7-diphenylimidazo[1,2-a]pyridin-3-yl)acetic acid is sourced from PubChem (CID 175016259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).