About 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate
1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate (PubChem CID 175016513) has the molecular formula C12H24O5Si
and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate.
Molecular Properties
| Compound Name | 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate |
| PubChem CID | 175016513 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate |
| SMILES | CCC(OC(=O)C(C)=C(C)C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H24O5Si/c1-8-11(18(14-5,15-6)16-7)17-12(13)10(4)9(2)3/h11H,8H2,1-7H3 |
| InChIKey | IXQJZXFYSGBPMZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate?
The IUPAC name of 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate (CID 175016513) is 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate.
What is the SMILES notation for 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate?
The canonical SMILES for 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate is CCC(OC(=O)C(C)=C(C)C)[Si](OC)(OC)OC.
What is the InChIKey of 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate?
The InChIKey is IXQJZXFYSGBPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O5Si/c1-8-11(18(14-5,15-6)16-7)17-12(13)10(4)9(2)3/h11H,8H2,1-7H3.
What are the key properties of 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate?
1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate has a molecular weight of 276.40 g/mol, XLogP of 2.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethoxysilylpropyl 2,3-dimethylbut-2-enoate is sourced from PubChem (CID 175016513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).