About bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate
bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate (PubChem CID 175017234) has the molecular formula C24H24F4N2O5
and a molecular weight of 496.46 g/mol. Its IUPAC name is bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate |
| PubChem CID | 175017234 |
| Molecular Formula | C24H24F4N2O5 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate |
| SMILES | O=C(CC(O)C(=O)ON1CCC[C@@H]1c1cc(F)ccc1F)ON1CCC[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C24H24F4N2O5/c25-14-5-7-18(27)16(11-14)20-3-1-9-29(20)34-23(32)13-22(31)24(33)35-30-10-2-4-21(30)17-12-15(26)6-8-19(17)28/h5-8,11-12,20-22,31H,1-4,9-10,13H2/t20-,21-,22?/m1/s1 |
| InChIKey | YOSVLXXDEQKUNI-JAZPPYFYSA-N |
| XLogP | 3.88 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate?
The IUPAC name of bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate (CID 175017234) is bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate.
What is the SMILES notation for bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate?
The canonical SMILES for bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate is O=C(CC(O)C(=O)ON1CCC[C@@H]1c1cc(F)ccc1F)ON1CCC[C@@H]1c1cc(F)ccc1F.
What is the InChIKey of bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate?
The InChIKey is YOSVLXXDEQKUNI-JAZPPYFYSA-N. The full InChI is InChI=1S/C24H24F4N2O5/c25-14-5-7-18(27)16(11-14)20-3-1-9-29(20)34-23(32)13-22(31)24(33)35-30-10-2-4-21(30)17-12-15(26)6-8-19(17)28/h5-8,11-12,20-22,31H,1-4,9-10,13H2/t20-,21-,22?/m1/s1.
What are the key properties of bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate?
bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate has a molecular weight of 496.46 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl] 2-hydroxybutanedioate is sourced from PubChem (CID 175017234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).