C28H22BrClF2N2O3 — CID 175017544
[2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chloro-3,6-difluorophenyl] pentanoate (PubChem CID 175017544) has the molecular formula C28H22BrClF2N2O3 and a molecular weight of 587.85 g/mol. Its IUPAC name is [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chloro-3,6-difluorophenyl] pentanoate.
| Compound Name | [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chloro-3,6-difluorophenyl] pentanoate |
|---|---|
| PubChem CID | 175017544 |
| Molecular Formula | C28H22BrClF2N2O3 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chloro-3,6-difluorophenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(F)c(Cl)cc(F)c1NC(=O)c1c(C)c(-c2ccccc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C28H22BrClF2N2O3/c1-3-4-10-22(35)37-27-24(32)19(30)14-20(31)26(27)34-28(36)23-15(2)25(16-8-6-5-7-9-16)33-21-12-11-17(29)13-18(21)23/h5-9,11-14H,3-4,10H2,1-2H3,(H,34,36) |
| InChIKey | OYDVKBKQMFMKOU-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|