About 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine
4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine (PubChem CID 175017589) has the molecular formula C25H27N
and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine |
| PubChem CID | 175017589 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ccccc2)c2c1-c1ccccc1C2(C)C |
| InChI | InChI=1S/C25H27N/c1-24(2,3)20-15-16-21(26-17-11-7-6-8-12-17)23-22(20)18-13-9-10-14-19(18)25(23,4)5/h6-16,26H,1-5H3 |
| InChIKey | VPOCHFAXTQLSIT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine?
The IUPAC name of 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine (CID 175017589) is 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine.
What is the SMILES notation for 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine?
The canonical SMILES for 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine is CC(C)(C)c1ccc(Nc2ccccc2)c2c1-c1ccccc1C2(C)C.
What is the InChIKey of 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine?
The InChIKey is VPOCHFAXTQLSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N/c1-24(2,3)20-15-16-21(26-17-11-7-6-8-12-17)23-22(20)18-13-9-10-14-19(18)25(23,4)5/h6-16,26H,1-5H3.
What are the key properties of 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine?
4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine has a molecular weight of 341.50 g/mol, XLogP of 7.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-9,9-dimethyl-N-phenylfluoren-1-amine is sourced from PubChem (CID 175017589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).